C18H30O4Si — CID 164816366
diethoxy-(2-methyl-2-pentyl-4H-1,3-benzodioxin-6-yl)silane (PubChem CID 164816366) has the molecular formula C18H30O4Si and a molecular weight of 338.52 g/mol. Its IUPAC name is diethoxy-(2-methyl-2-pentyl-4H-1,3-benzodioxin-6-yl)silane.
| Compound Name | diethoxy-(2-methyl-2-pentyl-4H-1,3-benzodioxin-6-yl)silane |
|---|---|
| PubChem CID | 164816366 |
| Molecular Formula | C18H30O4Si |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | diethoxy-(2-methyl-2-pentyl-4H-1,3-benzodioxin-6-yl)silane |
| SMILES | CCCCCC1(C)OCc2cc([SiH](OCC)OCC)ccc2O1 |
| InChI | InChI=1S/C18H30O4Si/c1-5-8-9-12-18(4)19-14-15-13-16(10-11-17(15)22-18)23(20-6-2)21-7-3/h10-11,13,23H,5-9,12,14H2,1-4H3 |
| InChIKey | UBHMAWHMEYWOTB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|