C11H14Cl2O2Si — CID 164816242
dichloro-(2-ethyl-2-methyl-4H-1,3-benzodioxin-6-yl)silane (PubChem CID 164816242) has the molecular formula C11H14Cl2O2Si and a molecular weight of 277.22 g/mol. Its IUPAC name is dichloro-(2-ethyl-2-methyl-4H-1,3-benzodioxin-6-yl)silane.
| Compound Name | dichloro-(2-ethyl-2-methyl-4H-1,3-benzodioxin-6-yl)silane |
|---|---|
| PubChem CID | 164816242 |
| Molecular Formula | C11H14Cl2O2Si |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | dichloro-(2-ethyl-2-methyl-4H-1,3-benzodioxin-6-yl)silane |
| SMILES | CCC1(C)OCc2cc([SiH](Cl)Cl)ccc2O1 |
| InChI | InChI=1S/C11H14Cl2O2Si/c1-3-11(2)14-7-8-6-9(16(12)13)4-5-10(8)15-11/h4-6,16H,3,7H2,1-2H3 |
| InChIKey | LBDMHYKBHAQENK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|