C11H11BrO4 — CID 115062931
2-(6-bromo-2-methyl-4H-1,3-benzodioxin-2-yl)acetic acid (PubChem CID 115062931) has the molecular formula C11H11BrO4 and a molecular weight of 287.11 g/mol. Its IUPAC name is 2-(6-bromo-2-methyl-4H-1,3-benzodioxin-2-yl)acetic acid.
| Compound Name | 2-(6-bromo-2-methyl-4H-1,3-benzodioxin-2-yl)acetic acid |
|---|---|
| PubChem CID | 115062931 |
| Molecular Formula | C11H11BrO4 |
| Molecular Weight | 287.11 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | 2-(6-bromo-2-methyl-4H-1,3-benzodioxin-2-yl)acetic acid |
| SMILES | CC1(CC(=O)O)OCc2cc(Br)ccc2O1 |
| InChI | InChI=1S/C11H11BrO4/c1-11(5-10(13)14)15-6-7-4-8(12)2-3-9(7)16-11/h2-4H,5-6H2,1H3,(H,13,14) |
| InChIKey | XQLZFFHSVWBVAF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.11 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |