C12H14BrNO4 — CID 138688059
2-[2-[(2-amino-5-bromophenyl)methyl]-1,3-dioxolan-2-yl]acetic acid (PubChem CID 138688059) has the molecular formula C12H14BrNO4 and a molecular weight of 316.15 g/mol. Its IUPAC name is 2-[2-[(2-amino-5-bromophenyl)methyl]-1,3-dioxolan-2-yl]acetic acid.
| Compound Name | 2-[2-[(2-amino-5-bromophenyl)methyl]-1,3-dioxolan-2-yl]acetic acid |
|---|---|
| PubChem CID | 138688059 |
| Molecular Formula | C12H14BrNO4 |
| Molecular Weight | 316.15 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 2-[2-[(2-amino-5-bromophenyl)methyl]-1,3-dioxolan-2-yl]acetic acid |
| SMILES | Nc1ccc(Br)cc1CC1(CC(=O)O)OCCO1 |
| InChI | InChI=1S/C12H14BrNO4/c13-9-1-2-10(14)8(5-9)6-12(7-11(15)16)17-3-4-18-12/h1-2,5H,3-4,6-7,14H2,(H,15,16) |
| InChIKey | PIMMCUCHCNBTRA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.15 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|