About CID 144689894
CID 144689894 (PubChem CID 144689894) has the molecular formula C7H8BrNO2S2
and a molecular weight of 282.18 g/mol.
Molecular Properties
| Compound Name | CID 144689894 |
| PubChem CID | 144689894 |
| Molecular Formula | C7H8BrNO2S2 |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 280.92 |
| IUPAC Name | — |
| SMILES | Nc1ccc(Br)cc1C(=O)O.SS |
| InChI | InChI=1S/C7H6BrNO2.H2S2/c8-4-1-2-6(9)5(3-4)7(10)11;1-2/h1-3H,9H2,(H,10,11);1-2H |
| InChIKey | LLONTTVNACPRNT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 144689894 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 144689894?
The IUPAC name of CID 144689894 (CID 144689894) is not available.
What is the SMILES notation for CID 144689894?
The canonical SMILES for CID 144689894 is Nc1ccc(Br)cc1C(=O)O.SS.
What is the InChIKey of CID 144689894?
The InChIKey is LLONTTVNACPRNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrNO2.H2S2/c8-4-1-2-6(9)5(3-4)7(10)11;1-2/h1-3H,9H2,(H,10,11);1-2H.
What are the key properties of CID 144689894?
CID 144689894 has a molecular weight of 282.18 g/mol, XLogP of 2.49, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 144689894 is sourced from PubChem (CID 144689894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).