C7H12O4 — CID 13085716
2-(2-ethyl-1,3-dioxolan-2-yl)acetic acid (PubChem CID 13085716) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is 2-(2-ethyl-1,3-dioxolan-2-yl)acetic acid.
| Compound Name | 2-(2-ethyl-1,3-dioxolan-2-yl)acetic acid |
|---|---|
| PubChem CID | 13085716 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 2-(2-ethyl-1,3-dioxolan-2-yl)acetic acid |
| SMILES | CCC1(CC(=O)O)OCCO1 |
| InChI | InChI=1S/C7H12O4/c1-2-7(5-6(8)9)10-3-4-11-7/h2-5H2,1H3,(H,8,9) |
| InChIKey | VHKWVBFIWYCGDC-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |