C15H30O4 — CID 167558063
methane;2-(2-nonyl-1,3-dioxolan-2-yl)acetic acid (PubChem CID 167558063) has the molecular formula C15H30O4 and a molecular weight of 274.40 g/mol. Its IUPAC name is methane;2-(2-nonyl-1,3-dioxolan-2-yl)acetic acid.
| Compound Name | methane;2-(2-nonyl-1,3-dioxolan-2-yl)acetic acid |
|---|---|
| PubChem CID | 167558063 |
| Molecular Formula | C15H30O4 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | methane;2-(2-nonyl-1,3-dioxolan-2-yl)acetic acid |
| SMILES | C.CCCCCCCCCC1(CC(=O)O)OCCO1 |
| InChI | InChI=1S/C14H26O4.CH4/c1-2-3-4-5-6-7-8-9-14(12-13(15)16)17-10-11-18-14;/h2-12H2,1H3,(H,15,16);1H4 |
| InChIKey | DGVRUUGDKYRTQZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|