C12H24O3 — CID 161116524
2,2-diethyl-1,3-dioxolane;pentan-3-one (PubChem CID 161116524) has the molecular formula C12H24O3 and a molecular weight of 216.32 g/mol. Its IUPAC name is 2,2-diethyl-1,3-dioxolane;pentan-3-one.
| Compound Name | 2,2-diethyl-1,3-dioxolane;pentan-3-one |
|---|---|
| PubChem CID | 161116524 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | 2,2-diethyl-1,3-dioxolane;pentan-3-one |
| SMILES | CCC(=O)CC.CCC1(CC)OCCO1 |
| InChI | InChI=1S/C7H14O2.C5H10O/c1-3-7(4-2)8-5-6-9-7;1-3-5(6)4-2/h3-6H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | UKJUTYLLWMPYKG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |