C18H21Br3O3 — CID 163052248
[(1'R,2R,2'R,5'S)-2',5,5'-tribromo-2',4',4'-trimethylspiro[3H-1-benzofuran-2,3'-cyclohexane]-1'-yl] acetate (PubChem CID 163052248) has the molecular formula C18H21Br3O3 and a molecular weight of 525.08 g/mol. Its IUPAC name is [(1'R,2R,2'R,5'S)-2',5,5'-tribromo-2',4',4'-trimethylspiro[3H-1-benzofuran-2,3'-cyclohexane]-1'-yl] acetate.
| Compound Name | [(1'R,2R,2'R,5'S)-2',5,5'-tribromo-2',4',4'-trimethylspiro[3H-1-benzofuran-2,3'-cyclohexane]-1'-yl] acetate |
|---|---|
| PubChem CID | 163052248 |
| Molecular Formula | C18H21Br3O3 |
| Molecular Weight | 525.08 g/mol |
| Exact Mass | 521.90 |
| IUPAC Name | [(1'R,2R,2'R,5'S)-2',5,5'-tribromo-2',4',4'-trimethylspiro[3H-1-benzofuran-2,3'-cyclohexane]-1'-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H](Br)C(C)(C)[C@]2(Cc3cc(Br)ccc3O2)[C@]1(C)Br |
| InChI | InChI=1S/C18H21Br3O3/c1-10(22)23-15-8-14(20)16(2,3)18(17(15,4)21)9-11-7-12(19)5-6-13(11)24-18/h5-7,14-15H,8-9H2,1-4H3/t14-,15+,17+,18+/m0/s1 |
| InChIKey | CAGDZOSVGZMMGW-BURFUSLBSA-N |
| XLogP | 5.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.08 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|