About (5-bromo-2',3-dioxospiro[1H-indene-2,5'-cyclohexane]-1'-yl) acetate
(5-bromo-2',3-dioxospiro[1H-indene-2,5'-cyclohexane]-1'-yl) acetate (PubChem CID 123230128) has the molecular formula C16H15BrO4
and a molecular weight of 351.20 g/mol. Its IUPAC name is (5-bromo-2',3-dioxospiro[1H-indene-2,5'-cyclohexane]-1'-yl) acetate.
Molecular Properties
| Compound Name | (5-bromo-2',3-dioxospiro[1H-indene-2,5'-cyclohexane]-1'-yl) acetate |
| PubChem CID | 123230128 |
| Molecular Formula | C16H15BrO4 |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | (5-bromo-2',3-dioxospiro[1H-indene-2,5'-cyclohexane]-1'-yl) acetate |
| SMILES | CC(=O)OC1CC2(CCC1=O)Cc1ccc(Br)cc1C2=O |
| InChI | InChI=1S/C16H15BrO4/c1-9(18)21-14-8-16(5-4-13(14)19)7-10-2-3-11(17)6-12(10)15(16)20/h2-3,6,14H,4-5,7-8H2,1H3 |
| InChIKey | XPPLCPLHVYNQHS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-bromo-2',3-dioxospiro[1H-indene-2,5'-cyclohexane]-1'-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromo-2',3-dioxospiro[1H-indene-2,5'-cyclohexane]-1'-yl) acetate?
The IUPAC name of (5-bromo-2',3-dioxospiro[1H-indene-2,5'-cyclohexane]-1'-yl) acetate (CID 123230128) is (5-bromo-2',3-dioxospiro[1H-indene-2,5'-cyclohexane]-1'-yl) acetate.
What is the SMILES notation for (5-bromo-2',3-dioxospiro[1H-indene-2,5'-cyclohexane]-1'-yl) acetate?
The canonical SMILES for (5-bromo-2',3-dioxospiro[1H-indene-2,5'-cyclohexane]-1'-yl) acetate is CC(=O)OC1CC2(CCC1=O)Cc1ccc(Br)cc1C2=O.
What is the InChIKey of (5-bromo-2',3-dioxospiro[1H-indene-2,5'-cyclohexane]-1'-yl) acetate?
The InChIKey is XPPLCPLHVYNQHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15BrO4/c1-9(18)21-14-8-16(5-4-13(14)19)7-10-2-3-11(17)6-12(10)15(16)20/h2-3,6,14H,4-5,7-8H2,1H3.
What are the key properties of (5-bromo-2',3-dioxospiro[1H-indene-2,5'-cyclohexane]-1'-yl) acetate?
(5-bromo-2',3-dioxospiro[1H-indene-2,5'-cyclohexane]-1'-yl) acetate has a molecular weight of 351.20 g/mol, XLogP of 2.86, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromo-2',3-dioxospiro[1H-indene-2,5'-cyclohexane]-1'-yl) acetate is sourced from PubChem (CID 123230128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).