C14H22O2S — CID 141058651
2-methyl-2-octylthieno[3,4-d][1,3]dioxole (PubChem CID 141058651) has the molecular formula C14H22O2S and a molecular weight of 254.39 g/mol. Its IUPAC name is 2-methyl-2-octylthieno[3,4-d][1,3]dioxole.
| Compound Name | 2-methyl-2-octylthieno[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 141058651 |
| Molecular Formula | C14H22O2S |
| Molecular Weight | 254.39 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-methyl-2-octylthieno[3,4-d][1,3]dioxole |
| SMILES | CCCCCCCCC1(C)Oc2cscc2O1 |
| InChI | InChI=1S/C14H22O2S/c1-3-4-5-6-7-8-9-14(2)15-12-10-17-11-13(12)16-14/h10-11H,3-9H2,1-2H3 |
| InChIKey | KDHBARGUQGBTOD-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.39 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|