C14H28O6 — CID 123140797
3-hexyl-3,6,6,9,9-pentamethyl-1,2,4,5,7,8-hexaoxonane (PubChem CID 123140797) has the molecular formula C14H28O6 and a molecular weight of 292.37 g/mol. Its IUPAC name is 3-hexyl-3,6,6,9,9-pentamethyl-1,2,4,5,7,8-hexaoxonane.
| Compound Name | 3-hexyl-3,6,6,9,9-pentamethyl-1,2,4,5,7,8-hexaoxonane |
|---|---|
| PubChem CID | 123140797 |
| Molecular Formula | C14H28O6 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 3-hexyl-3,6,6,9,9-pentamethyl-1,2,4,5,7,8-hexaoxonane |
| SMILES | CCCCCCC1(C)OOC(C)(C)OOC(C)(C)OO1 |
| InChI | InChI=1S/C14H28O6/c1-7-8-9-10-11-14(6)19-17-12(2,3)15-16-13(4,5)18-20-14/h7-11H2,1-6H3 |
| InChIKey | BUVMXFBAMGAIEN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|