C36H72O4S — CID 166754801
4,5,8,9-tetraheptyl-4,5,8,9-tetramethyl-1,3,6,7,2-tetraoxathionane (PubChem CID 166754801) has the molecular formula C36H72O4S and a molecular weight of 601.04 g/mol. Its IUPAC name is 4,5,8,9-tetraheptyl-4,5,8,9-tetramethyl-1,3,6,7,2-tetraoxathionane.
| Compound Name | 4,5,8,9-tetraheptyl-4,5,8,9-tetramethyl-1,3,6,7,2-tetraoxathionane |
|---|---|
| PubChem CID | 166754801 |
| Molecular Formula | C36H72O4S |
| Molecular Weight | 601.04 g/mol |
| Exact Mass | 600.52 |
| IUPAC Name | 4,5,8,9-tetraheptyl-4,5,8,9-tetramethyl-1,3,6,7,2-tetraoxathionane |
| SMILES | CCCCCCCC1(C)OOC(C)(CCCCCCC)C(C)(CCCCCCC)OSOC1(C)CCCCCCC |
| InChI | InChI=1S/C36H72O4S/c1-9-13-17-21-25-29-33(5)35(7,31-27-23-19-15-11-3)39-41-40-36(8,32-28-24-20-16-12-4)34(6,38-37-33)30-26-22-18-14-10-2/h9-32H2,1-8H3 |
| InChIKey | WNNRSLIZBSKLOV-UHFFFAOYSA-N |
| XLogP | 13.02 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.04 |
| LogP ≤ 5 | 13.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|