About 2-icosyl-2-methyloxirane
2-icosyl-2-methyloxirane (PubChem CID 87753382) has the molecular formula C23H46O
and a molecular weight of 338.62 g/mol. Its IUPAC name is 2-icosyl-2-methyloxirane.
Molecular Properties
| Compound Name | 2-icosyl-2-methyloxirane |
| PubChem CID | 87753382 |
| Molecular Formula | C23H46O |
| Molecular Weight | 338.62 g/mol |
| Exact Mass | 338.35 |
| IUPAC Name | 2-icosyl-2-methyloxirane |
| SMILES | CCCCCCCCCCCCCCCCCCCCC1(C)CO1 |
| InChI | InChI=1S/C23H46O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23(2)22-24-23/h3-22H2,1-2H3 |
| InChIKey | GFMZNNYRFQCJLV-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.62 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-icosyl-2-methyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-icosyl-2-methyloxirane?
The IUPAC name of 2-icosyl-2-methyloxirane (CID 87753382) is 2-icosyl-2-methyloxirane.
What is the SMILES notation for 2-icosyl-2-methyloxirane?
The canonical SMILES for 2-icosyl-2-methyloxirane is CCCCCCCCCCCCCCCCCCCCC1(C)CO1.
What is the InChIKey of 2-icosyl-2-methyloxirane?
The InChIKey is GFMZNNYRFQCJLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H46O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23(2)22-24-23/h3-22H2,1-2H3.
What are the key properties of 2-icosyl-2-methyloxirane?
2-icosyl-2-methyloxirane has a molecular weight of 338.62 g/mol, XLogP of 8.21, 19 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-icosyl-2-methyloxirane is sourced from PubChem (CID 87753382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).