About 2-methyl-2-nonadecyloxirane;phosphoric acid
2-methyl-2-nonadecyloxirane;phosphoric acid (PubChem CID 87754305) has the molecular formula C22H50O9P2
and a molecular weight of 520.58 g/mol. Its IUPAC name is 2-methyl-2-nonadecyloxirane;phosphoric acid.
Molecular Properties
| Compound Name | 2-methyl-2-nonadecyloxirane;phosphoric acid |
| PubChem CID | 87754305 |
| Molecular Formula | C22H50O9P2 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | 2-methyl-2-nonadecyloxirane;phosphoric acid |
| SMILES | CCCCCCCCCCCCCCCCCCCC1(C)CO1.O=P(O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C22H44O.2H3O4P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(2)21-23-22;2*1-5(2,3)4/h3-21H2,1-2H3;2*(H3,1,2,3,4) |
| InChIKey | ZJUIIOXSFNSYNO-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 168.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-2-nonadecyloxirane;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-nonadecyloxirane;phosphoric acid?
The IUPAC name of 2-methyl-2-nonadecyloxirane;phosphoric acid (CID 87754305) is 2-methyl-2-nonadecyloxirane;phosphoric acid.
What is the SMILES notation for 2-methyl-2-nonadecyloxirane;phosphoric acid?
The canonical SMILES for 2-methyl-2-nonadecyloxirane;phosphoric acid is CCCCCCCCCCCCCCCCCCCC1(C)CO1.O=P(O)(O)O.O=P(O)(O)O.
What is the InChIKey of 2-methyl-2-nonadecyloxirane;phosphoric acid?
The InChIKey is ZJUIIOXSFNSYNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H44O.2H3O4P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(2)21-23-22;2*1-5(2,3)4/h3-21H2,1-2H3;2*(H3,1,2,3,4).
What are the key properties of 2-methyl-2-nonadecyloxirane;phosphoric acid?
2-methyl-2-nonadecyloxirane;phosphoric acid has a molecular weight of 520.58 g/mol, XLogP of 5.96, 18 rotatable bonds, 6 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-nonadecyloxirane;phosphoric acid is sourced from PubChem (CID 87754305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).