C33H66O6 — CID 10745423
3,3,6,6,9,9-hexapentyl-1,2,4,5,7,8-hexaoxonane (PubChem CID 10745423) has the molecular formula C33H66O6 and a molecular weight of 558.89 g/mol. Its IUPAC name is 3,3,6,6,9,9-hexapentyl-1,2,4,5,7,8-hexaoxonane.
| Compound Name | 3,3,6,6,9,9-hexapentyl-1,2,4,5,7,8-hexaoxonane |
|---|---|
| PubChem CID | 10745423 |
| Molecular Formula | C33H66O6 |
| Molecular Weight | 558.89 g/mol |
| Exact Mass | 558.49 |
| IUPAC Name | 3,3,6,6,9,9-hexapentyl-1,2,4,5,7,8-hexaoxonane |
| SMILES | CCCCCC1(CCCCC)OOC(CCCCC)(CCCCC)OOC(CCCCC)(CCCCC)OO1 |
| InChI | InChI=1S/C33H66O6/c1-7-13-19-25-31(26-20-14-8-2)34-36-32(27-21-15-9-3,28-22-16-10-4)38-39-33(37-35-31,29-23-17-11-5)30-24-18-12-6/h7-30H2,1-6H3 |
| InChIKey | KVRDZJJJBRZDIQ-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.89 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|