About 2-heptyl-2-octyl-1,3-dioxole
2-heptyl-2-octyl-1,3-dioxole (PubChem CID 141318565) has the molecular formula C18H34O2
and a molecular weight of 282.47 g/mol. Its IUPAC name is 2-heptyl-2-octyl-1,3-dioxole.
Molecular Properties
| Compound Name | 2-heptyl-2-octyl-1,3-dioxole |
| PubChem CID | 141318565 |
| Molecular Formula | C18H34O2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.26 |
| IUPAC Name | 2-heptyl-2-octyl-1,3-dioxole |
| SMILES | CCCCCCCCC1(CCCCCCC)OC=CO1 |
| InChI | InChI=1S/C18H34O2/c1-3-5-7-9-11-13-15-18(19-16-17-20-18)14-12-10-8-6-4-2/h16-17H,3-15H2,1-2H3 |
| InChIKey | ZVEAFJKFFMDBQL-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-heptyl-2-octyl-1,3-dioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-heptyl-2-octyl-1,3-dioxole?
The IUPAC name of 2-heptyl-2-octyl-1,3-dioxole (CID 141318565) is 2-heptyl-2-octyl-1,3-dioxole.
What is the SMILES notation for 2-heptyl-2-octyl-1,3-dioxole?
The canonical SMILES for 2-heptyl-2-octyl-1,3-dioxole is CCCCCCCCC1(CCCCCCC)OC=CO1.
What is the InChIKey of 2-heptyl-2-octyl-1,3-dioxole?
The InChIKey is ZVEAFJKFFMDBQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O2/c1-3-5-7-9-11-13-15-18(19-16-17-20-18)14-12-10-8-6-4-2/h16-17H,3-15H2,1-2H3.
What are the key properties of 2-heptyl-2-octyl-1,3-dioxole?
2-heptyl-2-octyl-1,3-dioxole has a molecular weight of 282.47 g/mol, XLogP of 6.31, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-heptyl-2-octyl-1,3-dioxole is sourced from PubChem (CID 141318565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).