About 3-ethyl-3-octyldioxirane
3-ethyl-3-octyldioxirane (PubChem CID 89239410) has the molecular formula C11H22O2
and a molecular weight of 186.29 g/mol. Its IUPAC name is 3-ethyl-3-octyldioxirane.
Molecular Properties
| Compound Name | 3-ethyl-3-octyldioxirane |
| PubChem CID | 89239410 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 3-ethyl-3-octyldioxirane |
| SMILES | CCCCCCCCC1(CC)OO1 |
| InChI | InChI=1S/C11H22O2/c1-3-5-6-7-8-9-10-11(4-2)12-13-11/h3-10H2,1-2H3 |
| InChIKey | ZJGGWJZWHKCDTK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-3-octyldioxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-3-octyldioxirane?
The IUPAC name of 3-ethyl-3-octyldioxirane (CID 89239410) is 3-ethyl-3-octyldioxirane.
What is the SMILES notation for 3-ethyl-3-octyldioxirane?
The canonical SMILES for 3-ethyl-3-octyldioxirane is CCCCCCCCC1(CC)OO1.
What is the InChIKey of 3-ethyl-3-octyldioxirane?
The InChIKey is ZJGGWJZWHKCDTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O2/c1-3-5-6-7-8-9-10-11(4-2)12-13-11/h3-10H2,1-2H3.
What are the key properties of 3-ethyl-3-octyldioxirane?
3-ethyl-3-octyldioxirane has a molecular weight of 186.29 g/mol, XLogP of 3.81, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-3-octyldioxirane is sourced from PubChem (CID 89239410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).