C11H22O4S — CID 154699276
3,3-dibutyl-1,2,4,5,7-tetraoxathiocane (PubChem CID 154699276) has the molecular formula C11H22O4S and a molecular weight of 250.36 g/mol. Its IUPAC name is 3,3-dibutyl-1,2,4,5,7-tetraoxathiocane.
| Compound Name | 3,3-dibutyl-1,2,4,5,7-tetraoxathiocane |
|---|---|
| PubChem CID | 154699276 |
| Molecular Formula | C11H22O4S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 3,3-dibutyl-1,2,4,5,7-tetraoxathiocane |
| SMILES | CCCCC1(CCCC)OOCSCOO1 |
| InChI | InChI=1S/C11H22O4S/c1-3-5-7-11(8-6-4-2)14-12-9-16-10-13-15-11/h3-10H2,1-2H3 |
| InChIKey | XLFGNMLUPHHFJD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|