C14H28O2 — CID 129267797
2,2-dibutyl-5-ethyl-1,3-dioxane (PubChem CID 129267797) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is 2,2-dibutyl-5-ethyl-1,3-dioxane.
| Compound Name | 2,2-dibutyl-5-ethyl-1,3-dioxane |
|---|---|
| PubChem CID | 129267797 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 2,2-dibutyl-5-ethyl-1,3-dioxane |
| SMILES | CCCCC1(CCCC)OCC(CC)CO1 |
| InChI | InChI=1S/C14H28O2/c1-4-7-9-14(10-8-5-2)15-11-13(6-3)12-16-14/h13H,4-12H2,1-3H3 |
| InChIKey | KXBKSJRWPYMKGY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |