C43H79NO2 — CID 155439873
2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxan-5-yl]-N-methylethanamine (PubChem CID 155439873) has the molecular formula C43H79NO2 and a molecular weight of 642.11 g/mol. Its IUPAC name is 2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxan-5-yl]-N-methylethanamine.
| Compound Name | 2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxan-5-yl]-N-methylethanamine |
|---|---|
| PubChem CID | 155439873 |
| Molecular Formula | C43H79NO2 |
| Molecular Weight | 642.11 g/mol |
| Exact Mass | 641.61 |
| IUPAC Name | 2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxan-5-yl]-N-methylethanamine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)OCC(CCNC)CO1 |
| InChI | InChI=1S/C43H79NO2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-37-43(45-40-42(41-46-43)36-39-44-3)38-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,42,44H,4-11,16-17,22-41H2,1-3H3/b14-12-,15-13-,20-18-,21-19- |
| InChIKey | RNUCBKQXASKDDY-QYCRHRGJSA-N |
| XLogP | 13.36 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.11 |
| LogP ≤ 5 | 13.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|