C38H73NO2S4 — CID 163386001
2-[2,2-bis[4-[[(Z)-dodec-3-enyl]disulfanyl]butyl]-1,3-dioxolan-4-yl]-N-methylethanamine (PubChem CID 163386001) has the molecular formula C38H73NO2S4 and a molecular weight of 704.28 g/mol. Its IUPAC name is 2-[2,2-bis[4-[[(Z)-dodec-3-enyl]disulfanyl]butyl]-1,3-dioxolan-4-yl]-N-methylethanamine.
| Compound Name | 2-[2,2-bis[4-[[(Z)-dodec-3-enyl]disulfanyl]butyl]-1,3-dioxolan-4-yl]-N-methylethanamine |
|---|---|
| PubChem CID | 163386001 |
| Molecular Formula | C38H73NO2S4 |
| Molecular Weight | 704.28 g/mol |
| Exact Mass | 703.45 |
| IUPAC Name | 2-[2,2-bis[4-[[(Z)-dodec-3-enyl]disulfanyl]butyl]-1,3-dioxolan-4-yl]-N-methylethanamine |
| SMILES | CCCCCCCC/C=C\CCSSCCCCC1(CCCCSSCC/C=C\CCCCCCCC)OCC(CCNC)O1 |
| InChI | InChI=1S/C38H73NO2S4/c1-4-6-8-10-12-14-16-18-20-24-32-42-44-34-26-22-29-38(40-36-37(41-38)28-31-39-3)30-23-27-35-45-43-33-25-21-19-17-15-13-11-9-7-5-2/h18-21,37,39H,4-17,22-36H2,1-3H3/b20-18-,21-19- |
| InChIKey | CQTFKZFQWJNULT-AUYXYSRISA-N |
| XLogP | 13.20 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.28 |
| LogP ≤ 5 | 13.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|