C48H88O2 — CID 130235971
5-(5-methylheptyl)-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxane (PubChem CID 130235971) has the molecular formula C48H88O2 and a molecular weight of 697.23 g/mol. Its IUPAC name is 5-(5-methylheptyl)-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxane.
| Compound Name | 5-(5-methylheptyl)-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxane |
|---|---|
| PubChem CID | 130235971 |
| Molecular Formula | C48H88O2 |
| Molecular Weight | 697.23 g/mol |
| Exact Mass | 696.68 |
| IUPAC Name | 5-(5-methylheptyl)-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxane |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)OCC(CCCCC(C)CC)CO1 |
| InChI | InChI=1S/C48H88O2/c1-5-8-10-12-14-16-18-20-22-24-26-28-30-32-34-38-42-48(49-44-47(45-50-48)41-37-36-40-46(4)7-3)43-39-35-33-31-29-27-25-23-21-19-17-15-13-11-9-6-2/h14-17,20-23,46-47H,5-13,18-19,24-45H2,1-4H3/b16-14-,17-15-,22-20-,23-21- |
| InChIKey | KNQOGNQIUVYBEX-ZPPAUJSGSA-N |
| XLogP | 16.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.23 |
| LogP ≤ 5 | 16.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|