C44H83NO2 — CID 139380831
N,N-dimethyl-1-[2-[(Z)-12-methyloctadec-9-enyl]-2-[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxan-5-yl]methanamine (PubChem CID 139380831) has the molecular formula C44H83NO2 and a molecular weight of 658.15 g/mol. Its IUPAC name is N,N-dimethyl-1-[2-[(Z)-12-methyloctadec-9-enyl]-2-[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxan-5-yl]methanamine.
| Compound Name | N,N-dimethyl-1-[2-[(Z)-12-methyloctadec-9-enyl]-2-[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxan-5-yl]methanamine |
|---|---|
| PubChem CID | 139380831 |
| Molecular Formula | C44H83NO2 |
| Molecular Weight | 658.15 g/mol |
| Exact Mass | 657.64 |
| IUPAC Name | N,N-dimethyl-1-[2-[(Z)-12-methyloctadec-9-enyl]-2-[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxan-5-yl]methanamine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\CC(C)CCCCCC)OCC(CN(C)C)CO1 |
| InChI | InChI=1S/C44H83NO2/c1-6-8-10-12-13-14-15-16-17-18-19-20-23-26-29-33-37-44(46-40-43(41-47-44)39-45(4)5)38-34-30-27-24-21-22-25-28-32-36-42(3)35-31-11-9-7-2/h13-14,16-17,28,32,42-43H,6-12,15,18-27,29-31,33-41H2,1-5H3/b14-13-,17-16-,32-28- |
| InChIKey | KRXQKSLZAAZFRA-FTUBUOIWSA-N |
| XLogP | 13.78 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.15 |
| LogP ≤ 5 | 13.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|