C46H83NO2 — CID 71466927
1-[(3aS,5S,7aR)-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl]-N,N-dimethylmethanamine (PubChem CID 71466927) has the molecular formula C46H83NO2 and a molecular weight of 682.17 g/mol. Its IUPAC name is 1-[(3aS,5S,7aR)-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[(3aS,5S,7aR)-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 71466927 |
| Molecular Formula | C46H83NO2 |
| Molecular Weight | 682.17 g/mol |
| Exact Mass | 681.64 |
| IUPAC Name | 1-[(3aS,5S,7aR)-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl]-N,N-dimethylmethanamine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)O[C@H]2C[C@@H](CN(C)C)CC[C@H]2O1 |
| InChI | InChI=1S/C46H83NO2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39-46(48-44-38-37-43(42-47(3)4)41-45(44)49-46)40-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,43-45H,5-12,17-18,23-42H2,1-4H3/b15-13-,16-14-,21-19-,22-20-/t43-,44+,45-/m0/s1 |
| InChIKey | HBBXHQQXPFWYLF-SRLDEIHASA-N |
| XLogP | 14.24 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.17 |
| LogP ≤ 5 | 14.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|