C44H79NO2 — CID 175819685
(3aR,6aS)-N,N-dimethyl-2,2-bis[(9Z)-octadeca-9,12-dienyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-5-amine (PubChem CID 175819685) has the molecular formula C44H79NO2 and a molecular weight of 654.12 g/mol. Its IUPAC name is (3aR,6aS)-N,N-dimethyl-2,2-bis[(9Z)-octadeca-9,12-dienyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-5-amine.
| Compound Name | (3aR,6aS)-N,N-dimethyl-2,2-bis[(9Z)-octadeca-9,12-dienyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-5-amine |
|---|---|
| PubChem CID | 175819685 |
| Molecular Formula | C44H79NO2 |
| Molecular Weight | 654.12 g/mol |
| Exact Mass | 653.61 |
| IUPAC Name | (3aR,6aS)-N,N-dimethyl-2,2-bis[(9Z)-octadeca-9,12-dienyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-5-amine |
| SMILES | CCCCCC=CC/C=C\CCCCCCCCC1(CCCCCCCC/C=C\CC=CCCCCC)O[C@H]2CC(N(C)C)C[C@H]2O1 |
| InChI | InChI=1S/C44H79NO2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-44(46-42-39-41(45(3)4)40-43(42)47-44)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,41-43H,5-12,17-18,23-40H2,1-4H3/b15-13?,16-14?,21-19-,22-20-/t41?,42-,43+,44? |
| InChIKey | LXEBVDLMCCKNTC-IPIRWXBKSA-N |
| XLogP | 13.60 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.12 |
| LogP ≤ 5 | 13.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|