C45H83NO2 — CID 143992121
2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole;N,N-dimethylmethanamine (PubChem CID 143992121) has the molecular formula C45H83NO2 and a molecular weight of 670.16 g/mol. Its IUPAC name is 2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole;N,N-dimethylmethanamine.
| Compound Name | 2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole;N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 143992121 |
| Molecular Formula | C45H83NO2 |
| Molecular Weight | 670.16 g/mol |
| Exact Mass | 669.64 |
| IUPAC Name | 2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole;N,N-dimethylmethanamine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)OC2CCCC2O1.CN(C)C |
| InChI | InChI=1S/C42H74O2.C3H9N/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38-42(43-40-36-35-37-41(40)44-42)39-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;1-4(2)3/h11-14,17-20,40-41H,3-10,15-16,21-39H2,1-2H3;1-3H3/b13-11-,14-12-,19-17-,20-18-; |
| InChIKey | OPLWRZIXLMRBJK-RSTCGTDESA-N |
| XLogP | 14.24 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.16 |
| LogP ≤ 5 | 14.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|