C44H76O2 — CID 58069751
(1R,2R,6S,7S)-4,4-bis[(9Z,12Z)-octadeca-9,12-dienyl]-3,5-dioxatricyclo[5.3.0.02,6]decane (PubChem CID 58069751) has the molecular formula C44H76O2 and a molecular weight of 637.09 g/mol. Its IUPAC name is (1R,2R,6S,7S)-4,4-bis[(9Z,12Z)-octadeca-9,12-dienyl]-3,5-dioxatricyclo[5.3.0.02,6]decane.
| Compound Name | (1R,2R,6S,7S)-4,4-bis[(9Z,12Z)-octadeca-9,12-dienyl]-3,5-dioxatricyclo[5.3.0.02,6]decane |
|---|---|
| PubChem CID | 58069751 |
| Molecular Formula | C44H76O2 |
| Molecular Weight | 637.09 g/mol |
| Exact Mass | 636.58 |
| IUPAC Name | (1R,2R,6S,7S)-4,4-bis[(9Z,12Z)-octadeca-9,12-dienyl]-3,5-dioxatricyclo[5.3.0.02,6]decane |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)O[C@@H]2[C@@H]3CCC[C@@H]3[C@@H]2O1 |
| InChI | InChI=1S/C44H76O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38-44(45-42-40-36-35-37-41(40)43(42)46-44)39-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,40-43H,3-10,15-16,21-39H2,1-2H3/b13-11-,14-12-,19-17-,20-18-/t40-,41+,42-,43+ |
| InChIKey | DLQHKNJJXDTVDX-XAIIPYSOSA-N |
| XLogP | 14.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.09 |
| LogP ≤ 5 | 14.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|