C43H77NO2 — CID 123980382
(3aS,6aS)-5-ethyl-2,2-bis(octadeca-9,12-dienyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole (PubChem CID 123980382) has the molecular formula C43H77NO2 and a molecular weight of 640.09 g/mol. Its IUPAC name is (3aS,6aS)-5-ethyl-2,2-bis(octadeca-9,12-dienyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole.
| Compound Name | (3aS,6aS)-5-ethyl-2,2-bis(octadeca-9,12-dienyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole |
|---|---|
| PubChem CID | 123980382 |
| Molecular Formula | C43H77NO2 |
| Molecular Weight | 640.09 g/mol |
| Exact Mass | 639.60 |
| IUPAC Name | (3aS,6aS)-5-ethyl-2,2-bis(octadeca-9,12-dienyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole |
| SMILES | CCCCCC=CCC=CCCCCCCCCC1(CCCCCCCCC=CCC=CCCCCC)O[C@H]2CN(CC)C[C@@H]2O1 |
| InChI | InChI=1S/C43H77NO2/c1-4-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-43(45-41-39-44(6-3)40-42(41)46-43)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-5-2/h13-16,19-22,41-42H,4-12,17-18,23-40H2,1-3H3/t41-,42-/m0/s1 |
| InChIKey | WADAAKRSKMEKNO-COCZKOEFSA-N |
| XLogP | 13.21 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.09 |
| LogP ≤ 5 | 13.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|