C46H83NO2 — CID 134314293
(1S)-1-[(3aR,6aR)-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-N,N-dimethylethanamine (PubChem CID 134314293) has the molecular formula C46H83NO2 and a molecular weight of 682.17 g/mol. Its IUPAC name is (1S)-1-[(3aR,6aR)-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-N,N-dimethylethanamine.
| Compound Name | (1S)-1-[(3aR,6aR)-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 134314293 |
| Molecular Formula | C46H83NO2 |
| Molecular Weight | 682.17 g/mol |
| Exact Mass | 681.64 |
| IUPAC Name | (1S)-1-[(3aR,6aR)-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-N,N-dimethylethanamine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)O[C@@H]2C([C@H](C)N(C)C)CC[C@H]2O1 |
| InChI | InChI=1S/C46H83NO2/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-40-46(48-44-39-38-43(45(44)49-46)42(3)47(4)5)41-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h14-17,20-23,42-45H,6-13,18-19,24-41H2,1-5H3/b16-14-,17-15-,22-20-,23-21-/t42-,43?,44+,45+/m0/s1 |
| InChIKey | DSOYHTNBOKTCRD-WQCTVNCUSA-N |
| XLogP | 14.23 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.17 |
| LogP ≤ 5 | 14.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|