C45H81NO2 — CID 46219015
(3aS,5S,7aR)-N,N-dimethyl-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-amine (PubChem CID 46219015) has the molecular formula C45H81NO2 and a molecular weight of 668.15 g/mol. Its IUPAC name is (3aS,5S,7aR)-N,N-dimethyl-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-amine.
| Compound Name | (3aS,5S,7aR)-N,N-dimethyl-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 46219015 |
| Molecular Formula | C45H81NO2 |
| Molecular Weight | 668.15 g/mol |
| Exact Mass | 667.63 |
| IUPAC Name | (3aS,5S,7aR)-N,N-dimethyl-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)O[C@H]2C[C@@H](N(C)C)CC[C@H]2O1 |
| InChI | InChI=1S/C45H81NO2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39-45(47-43-38-37-42(46(3)4)41-44(43)48-45)40-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,42-44H,5-12,17-18,23-41H2,1-4H3/b15-13-,16-14-,21-19-,22-20-/t42-,43+,44-/m0/s1 |
| InChIKey | SXIHLOZEXNGFMG-SKNVVJLOSA-N |
| XLogP | 13.99 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.15 |
| LogP ≤ 5 | 13.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|