C46H81NO2 — CID 71467216
(1R,2R,6S,7S,8R)-N,N-dimethyl-4,4-bis[(9Z,12Z)-octadeca-9,12-dienyl]-3,5-dioxatricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 71467216) has the molecular formula C46H81NO2 and a molecular weight of 680.16 g/mol. Its IUPAC name is (1R,2R,6S,7S,8R)-N,N-dimethyl-4,4-bis[(9Z,12Z)-octadeca-9,12-dienyl]-3,5-dioxatricyclo[5.2.1.02,6]decan-8-amine.
| Compound Name | (1R,2R,6S,7S,8R)-N,N-dimethyl-4,4-bis[(9Z,12Z)-octadeca-9,12-dienyl]-3,5-dioxatricyclo[5.2.1.02,6]decan-8-amine |
|---|---|
| PubChem CID | 71467216 |
| Molecular Formula | C46H81NO2 |
| Molecular Weight | 680.16 g/mol |
| Exact Mass | 679.63 |
| IUPAC Name | (1R,2R,6S,7S,8R)-N,N-dimethyl-4,4-bis[(9Z,12Z)-octadeca-9,12-dienyl]-3,5-dioxatricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)O[C@@H]2[C@@H]3C[C@H]([C@@H]2O1)[C@H](N(C)C)C3 |
| InChI | InChI=1S/C46H81NO2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-46(48-44-41-39-42(45(44)49-46)43(40-41)47(3)4)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,41-45H,5-12,17-18,23-40H2,1-4H3/b15-13-,16-14-,21-19-,22-20-/t41-,42+,43-,44-,45+/m1/s1 |
| InChIKey | YVWQNVPXRVJORC-OQYSKIDYSA-N |
| XLogP | 13.84 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.16 |
| LogP ≤ 5 | 13.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|