C47H81NO2 — CID 71217401
(2S,6R)-N,N-dimethyl-4,4-bis[(9Z,12Z)-octadeca-9,12-dienyl]-3,5-dioxatetracyclo[5.4.0.01,10.02,6]undecan-9-amine (PubChem CID 71217401) has the molecular formula C47H81NO2 and a molecular weight of 692.17 g/mol. Its IUPAC name is (2S,6R)-N,N-dimethyl-4,4-bis[(9Z,12Z)-octadeca-9,12-dienyl]-3,5-dioxatetracyclo[5.4.0.01,10.02,6]undecan-9-amine.
| Compound Name | (2S,6R)-N,N-dimethyl-4,4-bis[(9Z,12Z)-octadeca-9,12-dienyl]-3,5-dioxatetracyclo[5.4.0.01,10.02,6]undecan-9-amine |
|---|---|
| PubChem CID | 71217401 |
| Molecular Formula | C47H81NO2 |
| Molecular Weight | 692.17 g/mol |
| Exact Mass | 691.63 |
| IUPAC Name | (2S,6R)-N,N-dimethyl-4,4-bis[(9Z,12Z)-octadeca-9,12-dienyl]-3,5-dioxatetracyclo[5.4.0.01,10.02,6]undecan-9-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)O[C@@H]2C3CC(N(C)C)C4CC43[C@@H]2O1 |
| InChI | InChI=1S/C47H81NO2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-46(49-44-41-39-43(48(3)4)42-40-47(41,42)45(44)50-46)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,41-45H,5-12,17-18,23-40H2,1-4H3/b15-13-,16-14-,21-19-,22-20-/t41?,42?,43?,44-,45-,47?/m1/s1 |
| InChIKey | CZNIFBDLODZAJI-UZHJIHDOSA-N |
| XLogP | 13.84 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.17 |
| LogP ≤ 5 | 13.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|