C46H83NO3 — CID 67475998
1-[(6S,6aS)-4-methoxy-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-N,N-dimethylmethanamine (PubChem CID 67475998) has the molecular formula C46H83NO3 and a molecular weight of 698.17 g/mol. Its IUPAC name is 1-[(6S,6aS)-4-methoxy-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[(6S,6aS)-4-methoxy-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 67475998 |
| Molecular Formula | C46H83NO3 |
| Molecular Weight | 698.17 g/mol |
| Exact Mass | 697.64 |
| IUPAC Name | 1-[(6S,6aS)-4-methoxy-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-N,N-dimethylmethanamine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)OC2C(OC)C[C@@H](CN(C)C)[C@@H]2O1 |
| InChI | InChI=1S/C46H83NO3/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-46(49-44-42(41-47(3)4)40-43(48-5)45(44)50-46)39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h14-17,20-23,42-45H,6-13,18-19,24-41H2,1-5H3/b16-14-,17-15-,22-20-,23-21-/t42-,43?,44-,45?/m0/s1 |
| InChIKey | BAGQLFWUOXUPCR-QDBGTWMLSA-N |
| XLogP | 13.47 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.17 |
| LogP ≤ 5 | 13.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|