C42H76O — CID 130459222
4-[(Z)-9-methylheptadec-11-enyl]-4-[(9Z,12Z)-octadeca-9,12-dienyl]cyclohexan-1-one (PubChem CID 130459222) has the molecular formula C42H76O and a molecular weight of 597.07 g/mol. Its IUPAC name is 4-[(Z)-9-methylheptadec-11-enyl]-4-[(9Z,12Z)-octadeca-9,12-dienyl]cyclohexan-1-one.
| Compound Name | 4-[(Z)-9-methylheptadec-11-enyl]-4-[(9Z,12Z)-octadeca-9,12-dienyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 130459222 |
| Molecular Formula | C42H76O |
| Molecular Weight | 597.07 g/mol |
| Exact Mass | 596.59 |
| IUPAC Name | 4-[(Z)-9-methylheptadec-11-enyl]-4-[(9Z,12Z)-octadeca-9,12-dienyl]cyclohexan-1-one |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCCC(C)C/C=C\CCCCC)CCC(=O)CC1 |
| InChI | InChI=1S/C42H76O/c1-4-6-8-10-12-13-14-15-16-17-18-19-20-22-26-30-36-42(38-34-41(43)35-39-42)37-31-27-23-21-25-29-33-40(3)32-28-24-11-9-7-5-2/h12-13,15-16,24,28,40H,4-11,14,17-23,25-27,29-39H2,1-3H3/b13-12-,16-15-,28-24- |
| InChIKey | UGBRYGVBWAJONF-VXVJEQRYSA-N |
| XLogP | 14.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.07 |
| LogP ≤ 5 | 14.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|