C44H88 — CID 172596693
ethane;propane;(6Z,9Z,28Z)-19,19,31-trimethylhexatriaconta-6,9,28-triene (PubChem CID 172596693) has the molecular formula C44H88 and a molecular weight of 617.19 g/mol. Its IUPAC name is ethane;propane;(6Z,9Z,28Z)-19,19,31-trimethylhexatriaconta-6,9,28-triene.
| Compound Name | ethane;propane;(6Z,9Z,28Z)-19,19,31-trimethylhexatriaconta-6,9,28-triene |
|---|---|
| PubChem CID | 172596693 |
| Molecular Formula | C44H88 |
| Molecular Weight | 617.19 g/mol |
| Exact Mass | 616.69 |
| IUPAC Name | ethane;propane;(6Z,9Z,28Z)-19,19,31-trimethylhexatriaconta-6,9,28-triene |
| SMILES | CC.CCC.CCCCC/C=C\C/C=C\CCCCCCCCC(C)(C)CCCCCCCC/C=C\CC(C)CCCCC |
| InChI | InChI=1S/C39H74.C3H8.C2H6/c1-6-8-10-11-12-13-14-15-16-17-18-19-22-25-28-32-36-39(4,5)37-33-29-26-23-20-21-24-27-31-35-38(3)34-30-9-7-2;1-3-2;1-2/h12-13,15-16,27,31,38H,6-11,14,17-26,28-30,32-37H2,1-5H3;3H2,1-2H3;1-2H3/b13-12-,16-15-,31-27-;; |
| InChIKey | BGLYOYXEQPCDFS-FDWDDHTISA-N |
| XLogP | 16.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 30 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.19 |
| LogP ≤ 5 | 16.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|