C18H34 — CID 177270095
(4E,7E)-2-methylheptadeca-4,7-diene (PubChem CID 177270095) has the molecular formula C18H34 and a molecular weight of 250.47 g/mol. Its IUPAC name is (4E,7E)-2-methylheptadeca-4,7-diene.
| Compound Name | (4E,7E)-2-methylheptadeca-4,7-diene |
|---|---|
| PubChem CID | 177270095 |
| Molecular Formula | C18H34 |
| Molecular Weight | 250.47 g/mol |
| Exact Mass | 250.27 |
| IUPAC Name | (4E,7E)-2-methylheptadeca-4,7-diene |
| SMILES | CCCCCCCCC/C=C/C/C=C/CC(C)C |
| InChI | InChI=1S/C18H34/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(2)3/h12-13,15-16,18H,4-11,14,17H2,1-3H3/b13-12+,16-15+ |
| InChIKey | MVWILKCWXVTFIC-XUPYMNJSSA-N |
| XLogP | 6.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.47 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|