C20H38 — CID 177270218
(4E,14E)-2-methylnonadeca-4,14-diene (PubChem CID 177270218) has the molecular formula C20H38 and a molecular weight of 278.52 g/mol. Its IUPAC name is (4E,14E)-2-methylnonadeca-4,14-diene.
| Compound Name | (4E,14E)-2-methylnonadeca-4,14-diene |
|---|---|
| PubChem CID | 177270218 |
| Molecular Formula | C20H38 |
| Molecular Weight | 278.52 g/mol |
| Exact Mass | 278.30 |
| IUPAC Name | (4E,14E)-2-methylnonadeca-4,14-diene |
| SMILES | CCCC/C=C/CCCCCCCC/C=C/CC(C)C |
| InChI | InChI=1S/C20H38/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(2)3/h7-8,17-18,20H,4-6,9-16,19H2,1-3H3/b8-7+,18-17+ |
| InChIKey | FCFFFCJXCFADAY-RSIFQWQVSA-N |
| XLogP | 7.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.52 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|