C13H24 — CID 123659021
2-methyldodeca-4,7-diene (PubChem CID 123659021) has the molecular formula C13H24 and a molecular weight of 180.34 g/mol. Its IUPAC name is 2-methyldodeca-4,7-diene.
| Compound Name | 2-methyldodeca-4,7-diene |
|---|---|
| PubChem CID | 123659021 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.34 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 2-methyldodeca-4,7-diene |
| SMILES | CCCCC=CCC=CCC(C)C |
| InChI | InChI=1S/C13H24/c1-4-5-6-7-8-9-10-11-12-13(2)3/h7-8,10-11,13H,4-6,9,12H2,1-3H3 |
| InChIKey | YHCMCTGQVLRSFZ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.34 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|