C19H34 — CID 173133183
(5Z,9Z,12Z)-2-methyloctadeca-5,9,12-triene (PubChem CID 173133183) has the molecular formula C19H34 and a molecular weight of 262.48 g/mol. Its IUPAC name is (5Z,9Z,12Z)-2-methyloctadeca-5,9,12-triene.
| Compound Name | (5Z,9Z,12Z)-2-methyloctadeca-5,9,12-triene |
|---|---|
| PubChem CID | 173133183 |
| Molecular Formula | C19H34 |
| Molecular Weight | 262.48 g/mol |
| Exact Mass | 262.27 |
| IUPAC Name | (5Z,9Z,12Z)-2-methyloctadeca-5,9,12-triene |
| SMILES | CCCCC/C=C\C/C=C\CC/C=C\CCC(C)C |
| InChI | InChI=1S/C19H34/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)3/h8-9,11-12,15-16,19H,4-7,10,13-14,17-18H2,1-3H3/b9-8-,12-11-,16-15- |
| InChIKey | IFKIJADBKRRMTL-UCVSHGSNSA-N |
| XLogP | 6.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.48 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|