C37H70O2 — CID 143992012
(6Z,27Z,30Z)-9-methylhexatriaconta-6,27,30-triene-18,18-diol (PubChem CID 143992012) has the molecular formula C37H70O2 and a molecular weight of 546.97 g/mol. Its IUPAC name is (6Z,27Z,30Z)-9-methylhexatriaconta-6,27,30-triene-18,18-diol.
| Compound Name | (6Z,27Z,30Z)-9-methylhexatriaconta-6,27,30-triene-18,18-diol |
|---|---|
| PubChem CID | 143992012 |
| Molecular Formula | C37H70O2 |
| Molecular Weight | 546.97 g/mol |
| Exact Mass | 546.54 |
| IUPAC Name | (6Z,27Z,30Z)-9-methylhexatriaconta-6,27,30-triene-18,18-diol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(O)(O)CCCCCCCCC(C)C/C=C\CCCCC |
| InChI | InChI=1S/C37H70O2/c1-4-6-8-10-12-13-14-15-16-17-18-19-20-22-26-30-34-37(38,39)35-31-27-23-21-25-29-33-36(3)32-28-24-11-9-7-5-2/h12-13,15-16,24,28,36,38-39H,4-11,14,17-23,25-27,29-35H2,1-3H3/b13-12-,16-15-,28-24- |
| InChIKey | AMQJDGBBBOUXBN-VXVJEQRYSA-N |
| XLogP | 12.15 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.97 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|