C11H22O3 — CID 142748309
(2-butyl-4-propyl-1,3-dioxolan-2-yl)methanol (PubChem CID 142748309) has the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. Its IUPAC name is (2-butyl-4-propyl-1,3-dioxolan-2-yl)methanol.
| Compound Name | (2-butyl-4-propyl-1,3-dioxolan-2-yl)methanol |
|---|---|
| PubChem CID | 142748309 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | (2-butyl-4-propyl-1,3-dioxolan-2-yl)methanol |
| SMILES | CCCCC1(CO)OCC(CCC)O1 |
| InChI | InChI=1S/C11H22O3/c1-3-5-7-11(9-12)13-8-10(14-11)6-4-2/h10,12H,3-9H2,1-2H3 |
| InChIKey | ZQQSWIFGNXFWPT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |