C13H25IO2 — CID 129239768
2,2-dibutyl-5-(iodomethyl)-1,3-dioxane (PubChem CID 129239768) has the molecular formula C13H25IO2 and a molecular weight of 340.25 g/mol. Its IUPAC name is 2,2-dibutyl-5-(iodomethyl)-1,3-dioxane.
| Compound Name | 2,2-dibutyl-5-(iodomethyl)-1,3-dioxane |
|---|---|
| PubChem CID | 129239768 |
| Molecular Formula | C13H25IO2 |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 2,2-dibutyl-5-(iodomethyl)-1,3-dioxane |
| SMILES | CCCCC1(CCCC)OCC(CI)CO1 |
| InChI | InChI=1S/C13H25IO2/c1-3-5-7-13(8-6-4-2)15-10-12(9-14)11-16-13/h12H,3-11H2,1-2H3 |
| InChIKey | BVWOOSVFCWELPO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|