About 2,2-dibutyl-5-(iodomethyl)-1,3-dioxane
2,2-dibutyl-5-(iodomethyl)-1,3-dioxane (PubChem CID 129239768) has the molecular formula C13H25IO2
and a molecular weight of 340.25 g/mol. Its IUPAC name is 2,2-dibutyl-5-(iodomethyl)-1,3-dioxane.
Molecular Properties
| Compound Name | 2,2-dibutyl-5-(iodomethyl)-1,3-dioxane |
| PubChem CID | 129239768 |
| Molecular Formula | C13H25IO2 |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 2,2-dibutyl-5-(iodomethyl)-1,3-dioxane |
| SMILES | CCCCC1(CCCC)OCC(CI)CO1 |
| InChI | InChI=1S/C13H25IO2/c1-3-5-7-13(8-6-4-2)15-10-12(9-14)11-16-13/h12H,3-11H2,1-2H3 |
| InChIKey | BVWOOSVFCWELPO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dibutyl-5-(iodomethyl)-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dibutyl-5-(iodomethyl)-1,3-dioxane?
The IUPAC name of 2,2-dibutyl-5-(iodomethyl)-1,3-dioxane (CID 129239768) is 2,2-dibutyl-5-(iodomethyl)-1,3-dioxane.
What is the SMILES notation for 2,2-dibutyl-5-(iodomethyl)-1,3-dioxane?
The canonical SMILES for 2,2-dibutyl-5-(iodomethyl)-1,3-dioxane is CCCCC1(CCCC)OCC(CI)CO1.
What is the InChIKey of 2,2-dibutyl-5-(iodomethyl)-1,3-dioxane?
The InChIKey is BVWOOSVFCWELPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25IO2/c1-3-5-7-13(8-6-4-2)15-10-12(9-14)11-16-13/h12H,3-11H2,1-2H3.
What are the key properties of 2,2-dibutyl-5-(iodomethyl)-1,3-dioxane?
2,2-dibutyl-5-(iodomethyl)-1,3-dioxane has a molecular weight of 340.25 g/mol, XLogP of 4.16, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dibutyl-5-(iodomethyl)-1,3-dioxane is sourced from PubChem (CID 129239768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).