About 2-butyl-2-methylthiirane
2-butyl-2-methylthiirane (PubChem CID 12666043) has the molecular formula C7H14S
and a molecular weight of 130.26 g/mol. Its IUPAC name is 2-butyl-2-methylthiirane.
Molecular Properties
| Compound Name | 2-butyl-2-methylthiirane |
| PubChem CID | 12666043 |
| Molecular Formula | C7H14S |
| Molecular Weight | 130.26 g/mol |
| Exact Mass | 130.08 |
| IUPAC Name | 2-butyl-2-methylthiirane |
| SMILES | CCCCC1(C)CS1 |
| InChI | InChI=1S/C7H14S/c1-3-4-5-7(2)6-8-7/h3-6H2,1-2H3 |
| InChIKey | GZTDWUCVKOPBAW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-2-methylthiirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-2-methylthiirane?
The IUPAC name of 2-butyl-2-methylthiirane (CID 12666043) is 2-butyl-2-methylthiirane.
What is the SMILES notation for 2-butyl-2-methylthiirane?
The canonical SMILES for 2-butyl-2-methylthiirane is CCCCC1(C)CS1.
What is the InChIKey of 2-butyl-2-methylthiirane?
The InChIKey is GZTDWUCVKOPBAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14S/c1-3-4-5-7(2)6-8-7/h3-6H2,1-2H3.
What are the key properties of 2-butyl-2-methylthiirane?
2-butyl-2-methylthiirane has a molecular weight of 130.26 g/mol, XLogP of 2.68, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-2-methylthiirane is sourced from PubChem (CID 12666043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).