C9H16N2S — CID 21316398
2-butyl-2-methyl-1,3-thiazolidine-4-carbonitrile (PubChem CID 21316398) has the molecular formula C9H16N2S and a molecular weight of 184.31 g/mol. Its IUPAC name is 2-butyl-2-methyl-1,3-thiazolidine-4-carbonitrile.
| Compound Name | 2-butyl-2-methyl-1,3-thiazolidine-4-carbonitrile |
|---|---|
| PubChem CID | 21316398 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 2-butyl-2-methyl-1,3-thiazolidine-4-carbonitrile |
| SMILES | CCCCC1(C)NC(C#N)CS1 |
| InChI | InChI=1S/C9H16N2S/c1-3-4-5-9(2)11-8(6-10)7-12-9/h8,11H,3-5,7H2,1-2H3 |
| InChIKey | YDYPRYOTBCINOE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |