About (1-pentylcyclopropyl) cyanate
(1-pentylcyclopropyl) cyanate (PubChem CID 57162275) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is (1-pentylcyclopropyl) cyanate.
Molecular Properties
| Compound Name | (1-pentylcyclopropyl) cyanate |
| PubChem CID | 57162275 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (1-pentylcyclopropyl) cyanate |
| SMILES | CCCCCC1(OC#N)CC1 |
| InChI | InChI=1S/C9H15NO/c1-2-3-4-5-9(6-7-9)11-8-10/h2-7H2,1H3 |
| InChIKey | NBWMKQLMMMIEQT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze (1-pentylcyclopropyl) cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-pentylcyclopropyl) cyanate?
The IUPAC name of (1-pentylcyclopropyl) cyanate (CID 57162275) is (1-pentylcyclopropyl) cyanate.
What is the SMILES notation for (1-pentylcyclopropyl) cyanate?
The canonical SMILES for (1-pentylcyclopropyl) cyanate is CCCCCC1(OC#N)CC1.
What is the InChIKey of (1-pentylcyclopropyl) cyanate?
The InChIKey is NBWMKQLMMMIEQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO/c1-2-3-4-5-9(6-7-9)11-8-10/h2-7H2,1H3.
What are the key properties of (1-pentylcyclopropyl) cyanate?
(1-pentylcyclopropyl) cyanate has a molecular weight of 153.22 g/mol, XLogP of 2.60, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-pentylcyclopropyl) cyanate is sourced from PubChem (CID 57162275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).