C13H24N2S — CID 21316404
2-methyl-2-octyl-1,3-thiazolidine-4-carbonitrile (PubChem CID 21316404) has the molecular formula C13H24N2S and a molecular weight of 240.42 g/mol. Its IUPAC name is 2-methyl-2-octyl-1,3-thiazolidine-4-carbonitrile.
| Compound Name | 2-methyl-2-octyl-1,3-thiazolidine-4-carbonitrile |
|---|---|
| PubChem CID | 21316404 |
| Molecular Formula | C13H24N2S |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 2-methyl-2-octyl-1,3-thiazolidine-4-carbonitrile |
| SMILES | CCCCCCCCC1(C)NC(C#N)CS1 |
| InChI | InChI=1S/C13H24N2S/c1-3-4-5-6-7-8-9-13(2)15-12(10-14)11-16-13/h12,15H,3-9,11H2,1-2H3 |
| InChIKey | ACHFJQVOAOQTEI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|