About azane;2,3-dimethyl-2-octadecyloxirane;hydrochloride
azane;2,3-dimethyl-2-octadecyloxirane;hydrochloride (PubChem CID 175468906) has the molecular formula C22H48ClNO
and a molecular weight of 378.09 g/mol. Its IUPAC name is azane;2,3-dimethyl-2-octadecyloxirane;hydrochloride.
Molecular Properties
| Compound Name | azane;2,3-dimethyl-2-octadecyloxirane;hydrochloride |
| PubChem CID | 175468906 |
| Molecular Formula | C22H48ClNO |
| Molecular Weight | 378.09 g/mol |
| Exact Mass | 377.34 |
| IUPAC Name | azane;2,3-dimethyl-2-octadecyloxirane;hydrochloride |
| SMILES | CCCCCCCCCCCCCCCCCCC1(C)OC1C.Cl.N |
| InChI | InChI=1S/C22H44O.ClH.H3N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(3)21(2)23-22;;/h21H,4-20H2,1-3H3;1H;1H3 |
| InChIKey | MQAZQNGRAUHQEZ-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.09 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze azane;2,3-dimethyl-2-octadecyloxirane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2,3-dimethyl-2-octadecyloxirane;hydrochloride?
The IUPAC name of azane;2,3-dimethyl-2-octadecyloxirane;hydrochloride (CID 175468906) is azane;2,3-dimethyl-2-octadecyloxirane;hydrochloride.
What is the SMILES notation for azane;2,3-dimethyl-2-octadecyloxirane;hydrochloride?
The canonical SMILES for azane;2,3-dimethyl-2-octadecyloxirane;hydrochloride is CCCCCCCCCCCCCCCCCCC1(C)OC1C.Cl.N.
What is the InChIKey of azane;2,3-dimethyl-2-octadecyloxirane;hydrochloride?
The InChIKey is MQAZQNGRAUHQEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H44O.ClH.H3N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(3)21(2)23-22;;/h21H,4-20H2,1-3H3;1H;1H3.
What are the key properties of azane;2,3-dimethyl-2-octadecyloxirane;hydrochloride?
azane;2,3-dimethyl-2-octadecyloxirane;hydrochloride has a molecular weight of 378.09 g/mol, XLogP of 8.40, 17 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2,3-dimethyl-2-octadecyloxirane;hydrochloride is sourced from PubChem (CID 175468906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).