C21H42O — CID 11638167
(2R)-2-hexadecyl-2,4-dimethyloxetane (PubChem CID 11638167) has the molecular formula C21H42O and a molecular weight of 310.57 g/mol. Its IUPAC name is (2R)-2-hexadecyl-2,4-dimethyloxetane.
| Compound Name | (2R)-2-hexadecyl-2,4-dimethyloxetane |
|---|---|
| PubChem CID | 11638167 |
| Molecular Formula | C21H42O |
| Molecular Weight | 310.57 g/mol |
| Exact Mass | 310.32 |
| IUPAC Name | (2R)-2-hexadecyl-2,4-dimethyloxetane |
| SMILES | CCCCCCCCCCCCCCCC[C@]1(C)CC(C)O1 |
| InChI | InChI=1S/C21H42O/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(3)19-20(2)22-21/h20H,4-19H2,1-3H3/t20?,21-/m1/s1 |
| InChIKey | DINNCUYCWFIJEB-BPGUCPLFSA-N |
| XLogP | 7.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.57 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|