C15H30O2 — CID 98092863
(2R,6S)-4,4,6-trimethyl-2-octyl-1,3-dioxane (PubChem CID 98092863) has the molecular formula C15H30O2 and a molecular weight of 242.40 g/mol. Its IUPAC name is (2R,6S)-4,4,6-trimethyl-2-octyl-1,3-dioxane.
| Compound Name | (2R,6S)-4,4,6-trimethyl-2-octyl-1,3-dioxane |
|---|---|
| PubChem CID | 98092863 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | (2R,6S)-4,4,6-trimethyl-2-octyl-1,3-dioxane |
| SMILES | CCCCCCCC[C@@H]1O[C@@H](C)CC(C)(C)O1 |
| InChI | InChI=1S/C15H30O2/c1-5-6-7-8-9-10-11-14-16-13(2)12-15(3,4)17-14/h13-14H,5-12H2,1-4H3/t13-,14+/m0/s1 |
| InChIKey | GYOVKTWOJRRTOL-UONOGXRCSA-N |
| XLogP | 4.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|